C25H27F5N4O5 — CID 74412495
2-hydroxy-2-methyl-N-[2-oxo-5-(2-phenylmethoxyethyl)-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 74412495) has the molecular formula C25H27F5N4O5 and a molecular weight of 558.50 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[2-oxo-5-(2-phenylmethoxyethyl)-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | 2-hydroxy-2-methyl-N-[2-oxo-5-(2-phenylmethoxyethyl)-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 74412495 |
| Molecular Formula | C25H27F5N4O5 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[2-oxo-5-(2-phenylmethoxyethyl)-3,4-dihydro-1H-1,5-benzodiazepin-3-yl]-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | CC(O)(C(=O)NCC(F)(F)C(F)(F)F)C(=O)NC1CN(CCOCc2ccccc2)c2ccccc2NC1=O |
| InChI | InChI=1S/C25H27F5N4O5/c1-23(38,21(36)31-15-24(26,27)25(28,29)30)22(37)33-18-13-34(11-12-39-14-16-7-3-2-4-8-16)19-10-6-5-9-17(19)32-20(18)35/h2-10,18,38H,11-15H2,1H3,(H,31,36)(H,32,35)(H,33,37) |
| InChIKey | VMZWPMZNESNWOS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|