C26H34O11 — CID 74413185
2-hydroxy-3-(1-hydroxyheptyl)-10-(1,2,6-trihydroxyhex-4-enyl)-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone (PubChem CID 74413185) has the molecular formula C26H34O11 and a molecular weight of 522.55 g/mol. Its IUPAC name is 2-hydroxy-3-(1-hydroxyheptyl)-10-(1,2,6-trihydroxyhex-4-enyl)-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone.
| Compound Name | 2-hydroxy-3-(1-hydroxyheptyl)-10-(1,2,6-trihydroxyhex-4-enyl)-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 74413185 |
| Molecular Formula | C26H34O11 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 2-hydroxy-3-(1-hydroxyheptyl)-10-(1,2,6-trihydroxyhex-4-enyl)-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
| SMILES | CCCCCCC(O)C1C2=C(CC(C(O)C(O)CC=CCO)CC3=C(C(=O)OC3=O)C1O)C(=O)OC2=O |
| InChI | InChI=1S/C26H34O11/c1-2-3-4-5-8-16(28)20-18-14(23(32)36-25(18)34)11-13(21(30)17(29)9-6-7-10-27)12-15-19(22(20)31)26(35)37-24(15)33/h6-7,13,16-17,20-22,27-31H,2-5,8-12H2,1H3 |
| InChIKey | GMIDBRPHCFRJEG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 187.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|