C21H27NO6 — CID 74415245
9-(2-methoxyethyl)-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 74415245) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 9-(2-methoxyethyl)-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 74415245 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 9-(2-methoxyethyl)-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COCCN1COC2CCC3C(=O)C(Oc4ccccc4OC)=COC3C2C1 |
| InChI | InChI=1S/C21H27NO6/c1-24-10-9-22-11-15-16(27-13-22)8-7-14-20(23)19(12-26-21(14)15)28-18-6-4-3-5-17(18)25-2/h3-6,12,14-16,21H,7-11,13H2,1-2H3 |
| InChIKey | QDQOQWPEXWFUSO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |