C23H29NO5 — CID 74415247
9-cyclopentyl-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 74415247) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 9-cyclopentyl-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 9-cyclopentyl-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 74415247 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 9-cyclopentyl-3-(2-methoxyphenoxy)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccccc1OC1=COC2C(CCC3OCN(C4CCCC4)CC32)C1=O |
| InChI | InChI=1S/C23H29NO5/c1-26-19-8-4-5-9-20(19)29-21-13-27-23-16(22(21)25)10-11-18-17(23)12-24(14-28-18)15-6-2-3-7-15/h4-5,8-9,13,15-18,23H,2-3,6-7,10-12,14H2,1H3 |
| InChIKey | YFXSBIJYNJMTRU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |