C24H33NO6 — CID 74415286
3-(2-ethoxyphenoxy)-9-(3-ethoxypropyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 74415286) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-(2-ethoxyphenoxy)-9-(3-ethoxypropyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 3-(2-ethoxyphenoxy)-9-(3-ethoxypropyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 74415286 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 3-(2-ethoxyphenoxy)-9-(3-ethoxypropyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | CCOCCCN1COC2CCC3C(=O)C(Oc4ccccc4OCC)=COC3C2C1 |
| InChI | InChI=1S/C24H33NO6/c1-3-27-13-7-12-25-14-18-19(30-16-25)11-10-17-23(26)22(15-29-24(17)18)31-21-9-6-5-8-20(21)28-4-2/h5-6,8-9,15,17-19,24H,3-4,7,10-14,16H2,1-2H3 |
| InChIKey | HAPOHARDMHCOEW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|