C15H18N3O2S+ — CID 7441666
1-ethyl-6-hydroxy-2-sulfanylidene-5-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pyrimidin-4-one (PubChem CID 7441666) has the molecular formula C15H18N3O2S+ and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-ethyl-6-hydroxy-2-sulfanylidene-5-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pyrimidin-4-one.
| Compound Name | 1-ethyl-6-hydroxy-2-sulfanylidene-5-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pyrimidin-4-one |
|---|---|
| PubChem CID | 7441666 |
| Molecular Formula | C15H18N3O2S+ |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-ethyl-6-hydroxy-2-sulfanylidene-5-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]pyrimidin-4-one |
| SMILES | CCn1c(O)c([C@@H]2[NH2+]CCc3ccccc32)c(=O)[nH]c1=S |
| InChI | InChI=1S/C15H17N3O2S/c1-2-18-14(20)11(13(19)17-15(18)21)12-10-6-4-3-5-9(10)7-8-16-12/h3-6,12,16,20H,2,7-8H2,1H3,(H,17,19,21)/p+1/t12-/m1/s1 |
| InChIKey | XZKJQIXAZDOUMR-GFCCVEGCSA-O |
| XLogP | 0.84 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|