About ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate
ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 74416674) has the molecular formula C20H31N3O4S
and a molecular weight of 409.55 g/mol. Its IUPAC name is ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate |
| PubChem CID | 74416674 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CCCN(S(=O)(=O)C2C(C)NNC2C)C1 |
| InChI | InChI=1S/C20H31N3O4S/c1-4-27-19(24)20(13-17-9-6-5-7-10-17)11-8-12-23(14-20)28(25,26)18-15(2)21-22-16(18)3/h5-7,9-10,15-16,18,21-22H,4,8,11-14H2,1-3H3 |
| InChIKey | KSTOVQIKYTUKOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate?
The IUPAC name of ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate (CID 74416674) is ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate.
What is the SMILES notation for ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate?
The canonical SMILES for ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate is CCOC(=O)C1(Cc2ccccc2)CCCN(S(=O)(=O)C2C(C)NNC2C)C1.
What is the InChIKey of ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate?
The InChIKey is KSTOVQIKYTUKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O4S/c1-4-27-19(24)20(13-17-9-6-5-7-10-17)11-8-12-23(14-20)28(25,26)18-15(2)21-22-16(18)3/h5-7,9-10,15-16,18,21-22H,4,8,11-14H2,1-3H3.
What are the key properties of ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate?
ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate has a molecular weight of 409.55 g/mol, XLogP of 1.46, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzyl-1-(3,5-dimethylpyrazolidin-4-yl)sulfonylpiperidine-3-carboxylate is sourced from PubChem (CID 74416674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).