About N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine
N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine (PubChem CID 74421305) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine.
Molecular Properties
| Compound Name | N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine |
| PubChem CID | 74421305 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine |
| SMILES | CON=C1CCC2CC1C2(C)C |
| InChI | InChI=1S/C10H17NO/c1-10(2)7-4-5-9(11-12-3)8(10)6-7/h7-8H,4-6H2,1-3H3 |
| InChIKey | ZIRVKTQWZHEGDQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine?
The IUPAC name of N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine (CID 74421305) is N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine.
What is the SMILES notation for N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine?
The canonical SMILES for N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine is CON=C1CCC2CC1C2(C)C.
What is the InChIKey of N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine?
The InChIKey is ZIRVKTQWZHEGDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-10(2)7-4-5-9(11-12-3)8(10)6-7/h7-8H,4-6H2,1-3H3.
What are the key properties of N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine?
N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine has a molecular weight of 167.25 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-6,6-dimethylbicyclo[3.1.1]heptan-2-imine is sourced from PubChem (CID 74421305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).