About but-1-ene-1,1,4,4-tetrol
but-1-ene-1,1,4,4-tetrol (PubChem CID 74421723) has the molecular formula C4H8O4
and a molecular weight of 120.10 g/mol. Its IUPAC name is but-1-ene-1,1,4,4-tetrol.
Molecular Properties
| Compound Name | but-1-ene-1,1,4,4-tetrol |
| PubChem CID | 74421723 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | but-1-ene-1,1,4,4-tetrol |
| SMILES | OC(O)=CCC(O)O |
| InChI | InChI=1S/C4H8O4/c5-3(6)1-2-4(7)8/h1,4-8H,2H2 |
| InChIKey | MMTRNBJBIZUPHO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene-1,1,4,4-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene-1,1,4,4-tetrol?
The IUPAC name of but-1-ene-1,1,4,4-tetrol (CID 74421723) is but-1-ene-1,1,4,4-tetrol.
What is the SMILES notation for but-1-ene-1,1,4,4-tetrol?
The canonical SMILES for but-1-ene-1,1,4,4-tetrol is OC(O)=CCC(O)O.
What is the InChIKey of but-1-ene-1,1,4,4-tetrol?
The InChIKey is MMTRNBJBIZUPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O4/c5-3(6)1-2-4(7)8/h1,4-8H,2H2.
What are the key properties of but-1-ene-1,1,4,4-tetrol?
but-1-ene-1,1,4,4-tetrol has a molecular weight of 120.10 g/mol, XLogP of -0.36, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene-1,1,4,4-tetrol is sourced from PubChem (CID 74421723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).