C21H23N5O2 — CID 74423575
1-amino-N'-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboximidamide (PubChem CID 74423575) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-amino-N'-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboximidamide.
| Compound Name | 1-amino-N'-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboximidamide |
|---|---|
| PubChem CID | 74423575 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-amino-N'-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboximidamide |
| SMILES | Cc1cn(-c2ccc3c(N)ncc(C(N)=NO)c3c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H23N5O2/c1-11-10-26(16-7-21(2,3)8-17(27)18(11)16)12-4-5-13-14(6-12)15(20(23)25-28)9-24-19(13)22/h4-6,9-10,28H,7-8H2,1-3H3,(H2,22,24)(H2,23,25) |
| InChIKey | PNCOSGWBGXXVHE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|