About N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine
N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine (PubChem CID 74425280) has the molecular formula C14H14N4O
and a molecular weight of 254.29 g/mol. Its IUPAC name is N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine |
| PubChem CID | 74425280 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine |
| SMILES | Nc1ncc2c(n1)CC(c1ccccc1)CC2=NO |
| InChI | InChI=1S/C14H14N4O/c15-14-16-8-11-12(17-14)6-10(7-13(11)18-19)9-4-2-1-3-5-9/h1-5,8,10,19H,6-7H2,(H2,15,16,17) |
| InChIKey | GHGOUZISPNLJFN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine?
The IUPAC name of N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine (CID 74425280) is N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine.
What is the SMILES notation for N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine?
The canonical SMILES for N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine is Nc1ncc2c(n1)CC(c1ccccc1)CC2=NO.
What is the InChIKey of N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine?
The InChIKey is GHGOUZISPNLJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O/c15-14-16-8-11-12(17-14)6-10(7-13(11)18-19)9-4-2-1-3-5-9/h1-5,8,10,19H,6-7H2,(H2,15,16,17).
What are the key properties of N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine?
N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine has a molecular weight of 254.29 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-7-phenyl-7,8-dihydro-6H-quinazolin-5-ylidene)hydroxylamine is sourced from PubChem (CID 74425280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).