C28H28N4O3 — CID 74428358
3-[6-[3-[4-(4-benzylpiperazin-1-yl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 74428358) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[6-[3-[4-(4-benzylpiperazin-1-yl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[6-[3-[4-(4-benzylpiperazin-1-yl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 74428358 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 3-[6-[3-[4-(4-benzylpiperazin-1-yl)phenyl]-3-oxoprop-1-enyl]-2-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1cccc(C=CC(=O)c2ccc(N3CCN(Cc4ccccc4)CC3)cc2)n1)NO |
| InChI | InChI=1S/C28H28N4O3/c33-27(15-11-24-7-4-8-25(29-24)12-16-28(34)30-35)23-9-13-26(14-10-23)32-19-17-31(18-20-32)21-22-5-2-1-3-6-22/h1-16,35H,17-21H2,(H,30,34) |
| InChIKey | WYEOSCCAOBGWRG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|