About bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium
bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium (PubChem CID 7442944) has the molecular formula C17H26NO+
and a molecular weight of 260.40 g/mol. Its IUPAC name is bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium.
Molecular Properties
| Compound Name | bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium |
| PubChem CID | 7442944 |
| Molecular Formula | C17H26NO+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium |
| SMILES | C=CC[NH+](CC=C)CCOc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H25NO/c1-6-8-18(9-7-2)10-11-19-17-15(4)12-14(3)13-16(17)5/h6-7,12-13H,1-2,8-11H2,3-5H3/p+1 |
| InChIKey | CNQSYLDRMRPVMA-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium?
The IUPAC name of bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium (CID 7442944) is bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium.
What is the SMILES notation for bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium?
The canonical SMILES for bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium is C=CC[NH+](CC=C)CCOc1c(C)cc(C)cc1C.
What is the InChIKey of bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium?
The InChIKey is CNQSYLDRMRPVMA-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H25NO/c1-6-8-18(9-7-2)10-11-19-17-15(4)12-14(3)13-16(17)5/h6-7,12-13H,1-2,8-11H2,3-5H3/p+1.
What are the key properties of bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium?
bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium has a molecular weight of 260.40 g/mol, XLogP of 2.25, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl)-[2-(2,4,6-trimethylphenoxy)ethyl]azanium is sourced from PubChem (CID 7442944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).