About ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate
ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate (PubChem CID 74429769) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate |
| PubChem CID | 74429769 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=CCNC1c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-2-16-13(15)11-8-9-14-12(11)10-6-4-3-5-7-10/h3-8,12,14H,2,9H2,1H3 |
| InChIKey | QMUKSRMPOOGHIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
The IUPAC name of ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate (CID 74429769) is ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate.
What is the SMILES notation for ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
The canonical SMILES for ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate is CCOC(=O)C1=CCNC1c1ccccc1.
What is the InChIKey of ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
The InChIKey is QMUKSRMPOOGHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-2-16-13(15)11-8-9-14-12(11)10-6-4-3-5-7-10/h3-8,12,14H,2,9H2,1H3.
What are the key properties of ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate has a molecular weight of 217.27 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 74429769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).