About 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide
3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide (PubChem CID 74430205) has the molecular formula C16H14ClNO4
and a molecular weight of 319.74 g/mol. Its IUPAC name is 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide |
| PubChem CID | 74430205 |
| Molecular Formula | C16H14ClNO4 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide |
| SMILES | CC(=CC1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)NCCO |
| InChI | InChI=1S/C16H14ClNO4/c1-9(16(22)18-6-7-19)8-12-13(17)15(21)11-5-3-2-4-10(11)14(12)20/h2-5,8,19H,6-7H2,1H3,(H,18,22) |
| InChIKey | DGFXFRQPPPIIRM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide?
The IUPAC name of 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide (CID 74430205) is 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide.
What is the SMILES notation for 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide?
The canonical SMILES for 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide is CC(=CC1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)NCCO.
What is the InChIKey of 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide?
The InChIKey is DGFXFRQPPPIIRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO4/c1-9(16(22)18-6-7-19)8-12-13(17)15(21)11-5-3-2-4-10(11)14(12)20/h2-5,8,19H,6-7H2,1H3,(H,18,22).
What are the key properties of 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide?
3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide has a molecular weight of 319.74 g/mol, XLogP of 1.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-hydroxyethyl)-2-methylprop-2-enamide is sourced from PubChem (CID 74430205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).