C18H17NOS — CID 744311
1-(2,6-dimethyl-1H-indol-3-yl)-2-phenylsulfanylethanone (PubChem CID 744311) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-(2,6-dimethyl-1H-indol-3-yl)-2-phenylsulfanylethanone.
| Compound Name | 1-(2,6-dimethyl-1H-indol-3-yl)-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 744311 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(2,6-dimethyl-1H-indol-3-yl)-2-phenylsulfanylethanone |
| SMILES | Cc1ccc2c(C(=O)CSc3ccccc3)c(C)[nH]c2c1 |
| InChI | InChI=1S/C18H17NOS/c1-12-8-9-15-16(10-12)19-13(2)18(15)17(20)11-21-14-6-4-3-5-7-14/h3-10,19H,11H2,1-2H3 |
| InChIKey | JMOQBPQDFVOMER-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |