C15H15N5O2 — CID 74440870
11-[(4-hydroxypiperidin-1-yl)methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5(13),6,8,10-hexaen-4-one (PubChem CID 74440870) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 11-[(4-hydroxypiperidin-1-yl)methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5(13),6,8,10-hexaen-4-one.
| Compound Name | 11-[(4-hydroxypiperidin-1-yl)methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5(13),6,8,10-hexaen-4-one |
|---|---|
| PubChem CID | 74440870 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 11-[(4-hydroxypiperidin-1-yl)methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,5(13),6,8,10-hexaen-4-one |
| SMILES | O=C1N=Nc2nc(CN3CCC(O)CC3)nc3cccc1c23 |
| InChI | InChI=1S/C15H15N5O2/c21-9-4-6-20(7-5-9)8-12-16-11-3-1-2-10-13(11)14(17-12)18-19-15(10)22/h1-3,9,21H,4-8H2 |
| InChIKey | XKCSBTSNWBINBI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |