About 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one
1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one (PubChem CID 744417) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one.
Molecular Properties
| Compound Name | 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one |
| PubChem CID | 744417 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one |
| SMILES | CC(C)=CC(=O)CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c1-15(2)13-18(20)14-19(21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13,21H,14H2,1-2H3 |
| InChIKey | IGQLSYIWHPQCAH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one?
The IUPAC name of 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one (CID 744417) is 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one.
What is the SMILES notation for 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one?
The canonical SMILES for 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one is CC(C)=CC(=O)CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one?
The InChIKey is IGQLSYIWHPQCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2/c1-15(2)13-18(20)14-19(21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13,21H,14H2,1-2H3.
What are the key properties of 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one?
1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one has a molecular weight of 280.37 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5-methyl-1,1-diphenylhex-4-en-3-one is sourced from PubChem (CID 744417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).