About (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one
(4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one (PubChem CID 744418) has the molecular formula C11H11F3O2
and a molecular weight of 232.20 g/mol. Its IUPAC name is (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one.
Molecular Properties
| Compound Name | (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one |
| PubChem CID | 744418 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one |
| SMILES | CC(=O)C[C@@](O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-8(15)7-10(16,11(12,13)14)9-5-3-2-4-6-9/h2-6,16H,7H2,1H3/t10-/m1/s1 |
| InChIKey | VJAXMKZOQDXQPI-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one?
The IUPAC name of (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one (CID 744418) is (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one.
What is the SMILES notation for (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one?
The canonical SMILES for (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one is CC(=O)C[C@@](O)(c1ccccc1)C(F)(F)F.
What is the InChIKey of (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one?
The InChIKey is VJAXMKZOQDXQPI-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H11F3O2/c1-8(15)7-10(16,11(12,13)14)9-5-3-2-4-6-9/h2-6,16H,7H2,1H3/t10-/m1/s1.
What are the key properties of (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one?
(4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one has a molecular weight of 232.20 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5,5,5-trifluoro-4-hydroxy-4-phenylpentan-2-one is sourced from PubChem (CID 744418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).