About (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone
(2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone (PubChem CID 744426) has the molecular formula C12H12ClF2NO
and a molecular weight of 259.68 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone |
| PubChem CID | 744426 |
| Molecular Formula | C12H12ClF2NO |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C12H12ClF2NO/c13-9-7-11(15)10(14)6-8(9)12(17)16-4-2-1-3-5-16/h6-7H,1-5H2 |
| InChIKey | KYOJSDFILXWPDR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone?
The IUPAC name of (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone (CID 744426) is (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone.
What is the SMILES notation for (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone?
The canonical SMILES for (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone is O=C(c1cc(F)c(F)cc1Cl)N1CCCCC1.
What is the InChIKey of (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone?
The InChIKey is KYOJSDFILXWPDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClF2NO/c13-9-7-11(15)10(14)6-8(9)12(17)16-4-2-1-3-5-16/h6-7H,1-5H2.
What are the key properties of (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone?
(2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone has a molecular weight of 259.68 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4,5-difluorophenyl)-piperidin-1-ylmethanone is sourced from PubChem (CID 744426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).