C24H36N2O3S — CID 74443472
N-[5-hydroxy-3,3,5-trimethyl-7a-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,2,3a,4,6,7-hexahydroinden-1-yl]thiophene-2-carboxamide (PubChem CID 74443472) has the molecular formula C24H36N2O3S and a molecular weight of 432.63 g/mol. Its IUPAC name is N-[5-hydroxy-3,3,5-trimethyl-7a-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,2,3a,4,6,7-hexahydroinden-1-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-hydroxy-3,3,5-trimethyl-7a-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,2,3a,4,6,7-hexahydroinden-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 74443472 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[5-hydroxy-3,3,5-trimethyl-7a-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,2,3a,4,6,7-hexahydroinden-1-yl]thiophene-2-carboxamide |
| SMILES | CC1(O)CCC2(CCC(=O)N3CCCC3)C(NC(=O)c3cccs3)CC(C)(C)C2C1 |
| InChI | InChI=1S/C24H36N2O3S/c1-22(2)16-19(25-21(28)17-7-6-14-30-17)24(11-10-23(3,29)15-18(22)24)9-8-20(27)26-12-4-5-13-26/h6-7,14,18-19,29H,4-5,8-13,15-16H2,1-3H3,(H,25,28) |
| InChIKey | BNNRORYFOLCHRO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |