C26H37F3N2O4 — CID 74443548
N-[5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-4-(trifluoromethyl)benzamide (PubChem CID 74443548) has the molecular formula C26H37F3N2O4 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 74443548 |
| Molecular Formula | C26H37F3N2O4 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | N-[5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-4-(trifluoromethyl)benzamide |
| SMILES | COCCNC(=O)CCC12CCC(C)(O)CC1C(C)(C)CC2NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H37F3N2O4/c1-23(2)16-20(31-22(33)17-5-7-18(8-6-17)26(27,28)29)25(10-9-21(32)30-13-14-35-4)12-11-24(3,34)15-19(23)25/h5-8,19-20,34H,9-16H2,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | YEOJQFBQPYQTDK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|