C13H26N6 — CID 744450
4-N,6-N-ditert-butyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 744450) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-N,6-N-ditert-butyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-ditert-butyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 744450 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 4-N,6-N-ditert-butyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(NC(C)(C)C)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C13H26N6/c1-12(2,3)17-9-14-10(18-13(4,5)6)16-11(15-9)19(7)8/h1-8H3,(H2,14,15,16,17,18) |
| InChIKey | JMANMLWURWYTNZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |