C19H29N3O2S — CID 74450980
N-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide (PubChem CID 74450980) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 74450980 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC2CCN1CC2CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H29N3O2S/c23-25(24,19-6-2-1-3-7-19)20-13-18-12-16-8-11-22(18)15-17(16)14-21-9-4-5-10-21/h1-3,6-7,16-18,20H,4-5,8-15H2 |
| InChIKey | LYXWLNHERINLJO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |