C19H30N2O2 — CID 744585
(3aR,9aS)-2-[3-(dimethylamino)propyl]-5,5-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindole-1,3-dione (PubChem CID 744585) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3aR,9aS)-2-[3-(dimethylamino)propyl]-5,5-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindole-1,3-dione.
| Compound Name | (3aR,9aS)-2-[3-(dimethylamino)propyl]-5,5-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 744585 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (3aR,9aS)-2-[3-(dimethylamino)propyl]-5,5-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-benzo[f]isoindole-1,3-dione |
| SMILES | CN(C)CCCN1C(=O)[C@H]2CC3=C(C[C@H]2C1=O)C(C)(C)CCC3 |
| InChI | InChI=1S/C19H30N2O2/c1-19(2)8-5-7-13-11-14-15(12-16(13)19)18(23)21(17(14)22)10-6-9-20(3)4/h14-15H,5-12H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | DTTYFBUJAORCHB-LSDHHAIUSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|