C23H28N2O4 — CID 7446646
N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 7446646) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 7446646 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cccc(N3CCCC3=O)c2)cc1OCC |
| InChI | InChI=1S/C23H28N2O4/c1-3-28-20-11-10-17(15-21(20)29-4-2)12-13-24-23(27)18-7-5-8-19(16-18)25-14-6-9-22(25)26/h5,7-8,10-11,15-16H,3-4,6,9,12-14H2,1-2H3,(H,24,27) |
| InChIKey | OBEIAHZWSYJJHP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |