About N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide
N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide (PubChem CID 744708) has the molecular formula C19H17NO2S
and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide |
| PubChem CID | 744708 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide |
| SMILES | CC(=O)N(/C=C1\Sc2ccccc2C1=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H17NO2S/c1-12-8-9-15(10-13(12)2)20(14(3)21)11-18-19(22)16-6-4-5-7-17(16)23-18/h4-11H,1-3H3/b18-11- |
| InChIKey | DXRWXXKVNYPFPW-WQRHYEAKSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_E(44)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide?
The IUPAC name of N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide (CID 744708) is N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide.
What is the SMILES notation for N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide?
The canonical SMILES for N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide is CC(=O)N(/C=C1\Sc2ccccc2C1=O)c1ccc(C)c(C)c1.
What is the InChIKey of N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide?
The InChIKey is DXRWXXKVNYPFPW-WQRHYEAKSA-N. The full InChI is InChI=1S/C19H17NO2S/c1-12-8-9-15(10-13(12)2)20(14(3)21)11-18-19(22)16-6-4-5-7-17(16)23-18/h4-11H,1-3H3/b18-11-.
What are the key properties of N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide?
N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide has a molecular weight of 323.42 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]acetamide is sourced from PubChem (CID 744708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).