C21H19NO6 — CID 7447236
3-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoic acid (PubChem CID 7447236) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 3-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoic acid.
| Compound Name | 3-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 7447236 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-[(2S)-3-[hydroxy(phenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]propanoic acid |
| SMILES | COc1cccc([C@H]2C(=C(O)c3ccccc3)C(=O)C(=O)N2CCC(=O)O)c1 |
| InChI | InChI=1S/C21H19NO6/c1-28-15-9-5-8-14(12-15)18-17(19(25)13-6-3-2-4-7-13)20(26)21(27)22(18)11-10-16(23)24/h2-9,12,18,25H,10-11H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | GNWPYYZZTKQXRH-SFHVURJKSA-N |
| XLogP | 2.59 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|