C22H21N2O5- — CID 7447242
3-[(2R)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]propanoate (PubChem CID 7447242) has the molecular formula C22H21N2O5- and a molecular weight of 393.42 g/mol. Its IUPAC name is 3-[(2R)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]propanoate.
| Compound Name | 3-[(2R)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 7447242 |
| Molecular Formula | C22H21N2O5- |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[(2R)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]propanoate |
| SMILES | CN(C)c1ccc([C@@H]2C(=C(O)c3ccccc3)C(=O)C(=O)N2CCC(=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-23(2)16-10-8-14(9-11-16)19-18(20(27)15-6-4-3-5-7-15)21(28)22(29)24(19)13-12-17(25)26/h3-11,19,27H,12-13H2,1-2H3,(H,25,26)/p-1/t19-/m1/s1 |
| InChIKey | YLSQTTHVPNFWOP-LJQANCHMSA-M |
| XLogP | 1.31 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|