C14H21N3O3+2 — CID 7447465
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide (PubChem CID 7447465) has the molecular formula C14H21N3O3+2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 7447465 |
| Molecular Formula | C14H21N3O3+2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide |
| SMILES | NC(=O)C[NH+]1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C14H19N3O3/c15-14(18)9-17-5-3-16(4-6-17)8-11-1-2-12-13(7-11)20-10-19-12/h1-2,7H,3-6,8-10H2,(H2,15,18)/p+2 |
| InChIKey | PJFZSTVTOAARPQ-UHFFFAOYSA-P |
| XLogP | -2.82 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |