C16H23FN2O — CID 744755
2-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 744755) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 2-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 744755 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccccc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C16H23FN2O/c1-15(2)9-11(10-16(3,4)19-15)18-14(20)12-7-5-6-8-13(12)17/h5-8,11,19H,9-10H2,1-4H3,(H,18,20) |
| InChIKey | ZMNVZYAYTFEADP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |