C15H24N4O4S — CID 74476847
3-[(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)sulfanyl]propanoic acid (PubChem CID 74476847) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-[(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 74476847 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-[(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)sulfanyl]propanoic acid |
| SMILES | CCCCCCN1C(SCCC(=O)O)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C15H24N4O4S/c1-3-4-5-6-8-19-11-12(18(2)14(23)17-13(11)22)16-15(19)24-9-7-10(20)21/h11-12H,3-9H2,1-2H3,(H,20,21)(H,17,22,23) |
| InChIKey | NDVPMOYZIQBYMI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|