About 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione
7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 74483300) has the molecular formula C18H30N5O2+
and a molecular weight of 348.47 g/mol. Its IUPAC name is 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione.
Molecular Properties
| Compound Name | 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
| PubChem CID | 74483300 |
| Molecular Formula | C18H30N5O2+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | CCCC[N+]1=C(CN2CCC(C)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H30N5O2/c1-5-6-9-23-14(12-22-10-7-13(2)8-11-22)19-16-15(23)17(24)21(4)18(25)20(16)3/h13,15H,5-12H2,1-4H3/q+1 |
| InChIKey | FYXJLLFVNZVHTF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione?
The IUPAC name of 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione (CID 74483300) is 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione.
What is the SMILES notation for 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione?
The canonical SMILES for 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione is CCCC[N+]1=C(CN2CCC(C)CC2)N=C2C1C(=O)N(C)C(=O)N2C.
What is the InChIKey of 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione?
The InChIKey is FYXJLLFVNZVHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N5O2/c1-5-6-9-23-14(12-22-10-7-13(2)8-11-22)19-16-15(23)17(24)21(4)18(25)20(16)3/h13,15H,5-12H2,1-4H3/q+1.
What are the key properties of 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione?
7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione has a molecular weight of 348.47 g/mol, XLogP of 1.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione is sourced from PubChem (CID 74483300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).