About 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium
1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium (PubChem CID 7448472) has the molecular formula C11H24N2+2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium.
Molecular Properties
| Compound Name | 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium |
| PubChem CID | 7448472 |
| Molecular Formula | C11H24N2+2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium |
| SMILES | C[C@@H]1CC[C@H]([NH+]2CC[NH+](C)CC2)C1 |
| InChI | InChI=1S/C11H22N2/c1-10-3-4-11(9-10)13-7-5-12(2)6-8-13/h10-11H,3-9H2,1-2H3/p+2/t10-,11+/m1/s1 |
| InChIKey | WMUCTWTUVZDNEP-MNOVXSKESA-P |
| XLogP | -1.41 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium?
The IUPAC name of 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium (CID 7448472) is 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium.
What is the SMILES notation for 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium?
The canonical SMILES for 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium is C[C@@H]1CC[C@H]([NH+]2CC[NH+](C)CC2)C1.
What is the InChIKey of 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium?
The InChIKey is WMUCTWTUVZDNEP-MNOVXSKESA-P. The full InChI is InChI=1S/C11H22N2/c1-10-3-4-11(9-10)13-7-5-12(2)6-8-13/h10-11H,3-9H2,1-2H3/p+2/t10-,11+/m1/s1.
What are the key properties of 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium?
1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium has a molecular weight of 184.33 g/mol, XLogP of -1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(1S,3R)-3-methylcyclopentyl]piperazine-1,4-diium is sourced from PubChem (CID 7448472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).