C10H20NO+ — CID 7448483
4-[(1S,3S)-3-methylcyclopentyl]morpholin-4-ium (PubChem CID 7448483) has the molecular formula C10H20NO+ and a molecular weight of 170.28 g/mol. Its IUPAC name is 4-[(1S,3S)-3-methylcyclopentyl]morpholin-4-ium.
| Compound Name | 4-[(1S,3S)-3-methylcyclopentyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7448483 |
| Molecular Formula | C10H20NO+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 4-[(1S,3S)-3-methylcyclopentyl]morpholin-4-ium |
| SMILES | C[C@H]1CC[C@H]([NH+]2CCOCC2)C1 |
| InChI | InChI=1S/C10H19NO/c1-9-2-3-10(8-9)11-4-6-12-7-5-11/h9-10H,2-8H2,1H3/p+1/t9-,10-/m0/s1 |
| InChIKey | VMTJNPYTOIGCFE-UWVGGRQHSA-O |
| XLogP | 0.09 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |