C22H26N2O3S — CID 7448551
[(1S,2Z,4R)-2-(diphenylhydrazinylidene)-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 7448551) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is [(1S,2Z,4R)-2-(diphenylhydrazinylidene)-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [(1S,2Z,4R)-2-(diphenylhydrazinylidene)-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 7448551 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(1S,2Z,4R)-2-(diphenylhydrazinylidene)-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)/C(=N\N(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C22H26N2O3S/c1-21(2)17-13-14-22(21,16-28(25,26)27)20(15-17)23-24(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17H,13-16H2,1-2H3,(H,25,26,27)/b23-20-/t17-,22-/m1/s1 |
| InChIKey | BXNLRHOZNIDDLX-RVSFCFPGSA-N |
| XLogP | 4.89 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|