C16H17ClN5O3S+ — CID 74486908
8-chloro-7-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74486908) has the molecular formula C16H17ClN5O3S+ and a molecular weight of 394.86 g/mol. Its IUPAC name is 8-chloro-7-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-chloro-7-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74486908 |
| Molecular Formula | C16H17ClN5O3S+ |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 8-chloro-7-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(Cl)=[N+]2CC(=O)N2CCc3sccc3C2)N(C)C1=O |
| InChI | InChI=1S/C16H17ClN5O3S/c1-19-13-12(14(24)20(2)16(19)25)22(15(17)18-13)8-11(23)21-5-3-10-9(7-21)4-6-26-10/h4,6,12H,3,5,7-8H2,1-2H3/q+1 |
| InChIKey | DNDPGWMEBXEDDX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|