About 3-(1,2-oxazol-5-yl)propanoate
3-(1,2-oxazol-5-yl)propanoate (PubChem CID 7449321) has the molecular formula C6H6NO3-
and a molecular weight of 140.12 g/mol. Its IUPAC name is 3-(1,2-oxazol-5-yl)propanoate.
Molecular Properties
| Compound Name | 3-(1,2-oxazol-5-yl)propanoate |
| PubChem CID | 7449321 |
| Molecular Formula | C6H6NO3- |
| Molecular Weight | 140.12 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 3-(1,2-oxazol-5-yl)propanoate |
| SMILES | O=C([O-])CCc1ccno1 |
| InChI | InChI=1S/C6H7NO3/c8-6(9)2-1-5-3-4-7-10-5/h3-4H,1-2H2,(H,8,9)/p-1 |
| InChIKey | YFYBODHSQLOQOF-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.12 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,2-oxazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-oxazol-5-yl)propanoate?
The IUPAC name of 3-(1,2-oxazol-5-yl)propanoate (CID 7449321) is 3-(1,2-oxazol-5-yl)propanoate.
What is the SMILES notation for 3-(1,2-oxazol-5-yl)propanoate?
The canonical SMILES for 3-(1,2-oxazol-5-yl)propanoate is O=C([O-])CCc1ccno1.
What is the InChIKey of 3-(1,2-oxazol-5-yl)propanoate?
The InChIKey is YFYBODHSQLOQOF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3/c8-6(9)2-1-5-3-4-7-10-5/h3-4H,1-2H2,(H,8,9)/p-1.
What are the key properties of 3-(1,2-oxazol-5-yl)propanoate?
3-(1,2-oxazol-5-yl)propanoate has a molecular weight of 140.12 g/mol, XLogP of -0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-5-yl)propanoate is sourced from PubChem (CID 7449321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).