C24H26FN5O2S — CID 74501673
1-[4-[5-(3-fluorophenyl)-2-(2-methoxyethylsulfanyl)pyrimidin-4-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)prop-2-en-1-one (PubChem CID 74501673) has the molecular formula C24H26FN5O2S and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[4-[5-(3-fluorophenyl)-2-(2-methoxyethylsulfanyl)pyrimidin-4-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[4-[5-(3-fluorophenyl)-2-(2-methoxyethylsulfanyl)pyrimidin-4-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 74501673 |
| Molecular Formula | C24H26FN5O2S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 1-[4-[5-(3-fluorophenyl)-2-(2-methoxyethylsulfanyl)pyrimidin-4-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)prop-2-en-1-one |
| SMILES | COCCSc1ncc(-c2cccc(F)c2)c(C2CCN(C(=O)C=Cc3cnc[nH]3)CC2)n1 |
| InChI | InChI=1S/C24H26FN5O2S/c1-32-11-12-33-24-27-15-21(18-3-2-4-19(25)13-18)23(29-24)17-7-9-30(10-8-17)22(31)6-5-20-14-26-16-28-20/h2-6,13-17H,7-12H2,1H3,(H,26,28) |
| InChIKey | ONEZQFOKXZDCPI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|