C28H25N3O3 — CID 74502992
N-[[7-(1-benzofuran-2-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 74502992) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[[7-(1-benzofuran-2-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[7-(1-benzofuran-2-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 74502992 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[[7-(1-benzofuran-2-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ncc2c(c1CNC(=O)C=Cc1ccccc1)CCN(C(=O)c1cc3ccccc3o1)C2 |
| InChI | InChI=1S/C28H25N3O3/c1-19-24(17-30-27(32)12-11-20-7-3-2-4-8-20)23-13-14-31(18-22(23)16-29-19)28(33)26-15-21-9-5-6-10-25(21)34-26/h2-12,15-16H,13-14,17-18H2,1H3,(H,30,32) |
| InChIKey | IKRVWEHSEJQVLZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|