C15H19ClNO2+ — CID 7450449
[5-(2-chlorophenyl)furan-2-yl]methyl-[(2R)-1-hydroxybutan-2-yl]azanium (PubChem CID 7450449) has the molecular formula C15H19ClNO2+ and a molecular weight of 280.77 g/mol. Its IUPAC name is [5-(2-chlorophenyl)furan-2-yl]methyl-[(2R)-1-hydroxybutan-2-yl]azanium.
| Compound Name | [5-(2-chlorophenyl)furan-2-yl]methyl-[(2R)-1-hydroxybutan-2-yl]azanium |
|---|---|
| PubChem CID | 7450449 |
| Molecular Formula | C15H19ClNO2+ |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [5-(2-chlorophenyl)furan-2-yl]methyl-[(2R)-1-hydroxybutan-2-yl]azanium |
| SMILES | CC[C@H](CO)[NH2+]Cc1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H18ClNO2/c1-2-11(10-18)17-9-12-7-8-15(19-12)13-5-3-4-6-14(13)16/h3-8,11,17-18H,2,9-10H2,1H3/p+1/t11-/m1/s1 |
| InChIKey | SEZMSQPZBPOVDG-LLVKDONJSA-O |
| XLogP | 2.43 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |