C16H24BrN2O+ — CID 7450757
[2-(3-bromo-4-methylanilino)-2-oxoethyl]-(cyclohexylmethyl)azanium (PubChem CID 7450757) has the molecular formula C16H24BrN2O+ and a molecular weight of 340.29 g/mol. Its IUPAC name is [2-(3-bromo-4-methylanilino)-2-oxoethyl]-(cyclohexylmethyl)azanium.
| Compound Name | [2-(3-bromo-4-methylanilino)-2-oxoethyl]-(cyclohexylmethyl)azanium |
|---|---|
| PubChem CID | 7450757 |
| Molecular Formula | C16H24BrN2O+ |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [2-(3-bromo-4-methylanilino)-2-oxoethyl]-(cyclohexylmethyl)azanium |
| SMILES | Cc1ccc(NC(=O)C[NH2+]CC2CCCCC2)cc1Br |
| InChI | InChI=1S/C16H23BrN2O/c1-12-7-8-14(9-15(12)17)19-16(20)11-18-10-13-5-3-2-4-6-13/h7-9,13,18H,2-6,10-11H2,1H3,(H,19,20)/p+1 |
| InChIKey | PBWULZGTNNSFJX-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |