C18H33N3O2 — CID 7450808
2-(2-morpholin-4-ylethylamino)-N-[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 7450808) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylamino)-N-[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-(2-morpholin-4-ylethylamino)-N-[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 7450808 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 2-(2-morpholin-4-ylethylamino)-N-[(1S,2R,4R)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@@H]2CC[C@@H](C2)[C@@]1(C)NC(=O)CNCCN1CCOCC1 |
| InChI | InChI=1S/C18H33N3O2/c1-17(2)14-4-5-15(12-14)18(17,3)20-16(22)13-19-6-7-21-8-10-23-11-9-21/h14-15,19H,4-13H2,1-3H3,(H,20,22)/t14-,15+,18-/m1/s1 |
| InChIKey | SVTNZVZWTDZKDD-RVKKMQEKSA-N |
| XLogP | 1.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|