About 1-prop-2-enylperimidine
1-prop-2-enylperimidine (PubChem CID 745096) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-prop-2-enylperimidine.
Molecular Properties
| Compound Name | 1-prop-2-enylperimidine |
| PubChem CID | 745096 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-prop-2-enylperimidine |
| SMILES | C=CCN1C=Nc2cccc3cccc1c23 |
| InChI | InChI=1S/C14H12N2/c1-2-9-16-10-15-12-7-3-5-11-6-4-8-13(16)14(11)12/h2-8,10H,1,9H2 |
| InChIKey | NHMWNTMJLVNEEJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enylperimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enylperimidine?
The IUPAC name of 1-prop-2-enylperimidine (CID 745096) is 1-prop-2-enylperimidine.
What is the SMILES notation for 1-prop-2-enylperimidine?
The canonical SMILES for 1-prop-2-enylperimidine is C=CCN1C=Nc2cccc3cccc1c23.
What is the InChIKey of 1-prop-2-enylperimidine?
The InChIKey is NHMWNTMJLVNEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-9-16-10-15-12-7-3-5-11-6-4-8-13(16)14(11)12/h2-8,10H,1,9H2.
What are the key properties of 1-prop-2-enylperimidine?
1-prop-2-enylperimidine has a molecular weight of 208.26 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enylperimidine is sourced from PubChem (CID 745096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).