C15H13ClN6O — CID 7451552
2-chloro-N-[(1R)-1-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide (PubChem CID 7451552) has the molecular formula C15H13ClN6O and a molecular weight of 328.76 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(1R)-1-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 7451552 |
| Molecular Formula | C15H13ClN6O |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cccnc1Cl)c1nc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C15H13ClN6O/c1-9(19-15(23)11-3-2-6-18-12(11)16)13-20-14(22-21-13)10-4-7-17-8-5-10/h2-9H,1H3,(H,19,23)(H,20,21,22)/t9-/m1/s1 |
| InChIKey | IRRGKLMTAYOKTJ-SECBINFHSA-N |
| XLogP | 2.41 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|