C13H15N5 — CID 74516256
N,N-dimethyl-N'-(1-quinoxalin-2-ylethylideneamino)methanimidamide (PubChem CID 74516256) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is N,N-dimethyl-N'-(1-quinoxalin-2-ylethylideneamino)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(1-quinoxalin-2-ylethylideneamino)methanimidamide |
|---|---|
| PubChem CID | 74516256 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N,N-dimethyl-N'-(1-quinoxalin-2-ylethylideneamino)methanimidamide |
| SMILES | CC(=NN=CN(C)C)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C13H15N5/c1-10(17-15-9-18(2)3)13-8-14-11-6-4-5-7-12(11)16-13/h4-9H,1-3H3 |
| InChIKey | JWXJZIWDBODMAY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|