About 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine
2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 745199) has the molecular formula C16H11Cl2FN4
and a molecular weight of 349.20 g/mol. Its IUPAC name is 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine |
| PubChem CID | 745199 |
| Molecular Formula | C16H11Cl2FN4 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | Fc1cnc(Nc2cccc(Cl)c2)nc1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2FN4/c17-10-3-1-5-12(7-10)21-15-14(19)9-20-16(23-15)22-13-6-2-4-11(18)8-13/h1-9H,(H2,20,21,22,23) |
| InChIKey | RUPMYJYSOQCMBT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine?
The IUPAC name of 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine (CID 745199) is 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine?
The canonical SMILES for 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine is Fc1cnc(Nc2cccc(Cl)c2)nc1Nc1cccc(Cl)c1.
What is the InChIKey of 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine?
The InChIKey is RUPMYJYSOQCMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2FN4/c17-10-3-1-5-12(7-10)21-15-14(19)9-20-16(23-15)22-13-6-2-4-11(18)8-13/h1-9H,(H2,20,21,22,23).
What are the key properties of 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine?
2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine has a molecular weight of 349.20 g/mol, XLogP of 5.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-bis(3-chlorophenyl)-5-fluoropyrimidine-2,4-diamine is sourced from PubChem (CID 745199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).