About [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium
[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium (PubChem CID 7452125) has the molecular formula C6H12NO2S+
and a molecular weight of 162.23 g/mol. Its IUPAC name is [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium.
Molecular Properties
| Compound Name | [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium |
| PubChem CID | 7452125 |
| Molecular Formula | C6H12NO2S+ |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO2S/c1-7(2)6-3-4-10(8,9)5-6/h3-4,6H,5H2,1-2H3/p+1/t6-/m1/s1 |
| InChIKey | DTGLDQIBKFKDDI-ZCFIWIBFSA-O |
| XLogP | -1.56 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium?
The IUPAC name of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium (CID 7452125) is [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium.
What is the SMILES notation for [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium?
The canonical SMILES for [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium is C[NH+](C)[C@@H]1C=CS(=O)(=O)C1.
What is the InChIKey of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium?
The InChIKey is DTGLDQIBKFKDDI-ZCFIWIBFSA-O. The full InChI is InChI=1S/C6H11NO2S/c1-7(2)6-3-4-10(8,9)5-6/h3-4,6H,5H2,1-2H3/p+1/t6-/m1/s1.
What are the key properties of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium?
[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium has a molecular weight of 162.23 g/mol, XLogP of -1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-dimethylazanium is sourced from PubChem (CID 7452125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).