About [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate (PubChem CID 7452184) has the molecular formula C17H31NO2
and a molecular weight of 281.44 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate.
Molecular Properties
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate |
| PubChem CID | 7452184 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C17H31NO2/c1-13(2)15-8-7-14(3)11-16(15)20-17(19)12-18-9-5-4-6-10-18/h13-16H,4-12H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | OGERQOKJJMDILG-OWCLPIDISA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate?
The IUPAC name of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate (CID 7452184) is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate.
What is the SMILES notation for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate?
The canonical SMILES for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate is CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CN1CCCCC1.
What is the InChIKey of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate?
The InChIKey is OGERQOKJJMDILG-OWCLPIDISA-N. The full InChI is InChI=1S/C17H31NO2/c1-13(2)15-8-7-14(3)11-16(15)20-17(19)12-18-9-5-4-6-10-18/h13-16H,4-12H2,1-3H3/t14-,15+,16-/m1/s1.
What are the key properties of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate?
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate has a molecular weight of 281.44 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-piperidin-1-ylacetate is sourced from PubChem (CID 7452184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).