C26H38O4 — CID 7452438
(1R,6R)-1,6-bis(4-butoxyphenyl)hexane-1,6-diol (PubChem CID 7452438) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is (1R,6R)-1,6-bis(4-butoxyphenyl)hexane-1,6-diol.
| Compound Name | (1R,6R)-1,6-bis(4-butoxyphenyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 7452438 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (1R,6R)-1,6-bis(4-butoxyphenyl)hexane-1,6-diol |
| SMILES | CCCCOc1ccc([C@H](O)CCCC[C@@H](O)c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C26H38O4/c1-3-5-19-29-23-15-11-21(12-16-23)25(27)9-7-8-10-26(28)22-13-17-24(18-14-22)30-20-6-4-2/h11-18,25-28H,3-10,19-20H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | OLBQEBCWCIGCCI-CLJLJLNGSA-N |
| XLogP | 6.37 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|